C19H14N2O2 — CID 72792898
3-[3-(3-hydroxyphenyl)-1H-pyrrolo[2,3-b]pyridin-5-yl]phenol (PubChem CID 72792898) has the molecular formula C19H14N2O2 and a molecular weight of 302.33 g/mol. Its IUPAC name is 3-[3-(3-hydroxyphenyl)-1H-pyrrolo[2,3-b]pyridin-5-yl]phenol.
| Compound Name | 3-[3-(3-hydroxyphenyl)-1H-pyrrolo[2,3-b]pyridin-5-yl]phenol |
|---|---|
| PubChem CID | 72792898 |
| Molecular Formula | C19H14N2O2 |
| Molecular Weight | 302.33 g/mol |
| Exact Mass | 302.11 |
| IUPAC Name | 3-[3-(3-hydroxyphenyl)-1H-pyrrolo[2,3-b]pyridin-5-yl]phenol |
| SMILES | Oc1cccc(-c2cnc3[nH]cc(-c4cccc(O)c4)c3c2)c1 |
| InChI | InChI=1S/C19H14N2O2/c22-15-5-1-3-12(7-15)14-9-17-18(11-21-19(17)20-10-14)13-4-2-6-16(23)8-13/h1-11,22-23H,(H,20,21) |
| InChIKey | MACHJSMEPKMVPA-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 69.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.33 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |