C22H16N2O2Se+2 — CID 154591061
6,6'-spirobi[pyrido[1,2-c][1,2,3]benzoxaselenazin-7-ium] (PubChem CID 154591061) has the molecular formula C22H16N2O2Se+2 and a molecular weight of 419.34 g/mol. Its IUPAC name is 6,6'-spirobi[pyrido[1,2-c][1,2,3]benzoxaselenazin-7-ium].
| Compound Name | 6,6'-spirobi[pyrido[1,2-c][1,2,3]benzoxaselenazin-7-ium] |
|---|---|
| PubChem CID | 154591061 |
| Molecular Formula | C22H16N2O2Se+2 |
| Molecular Weight | 419.34 g/mol |
| Exact Mass | 420.04 |
| IUPAC Name | 6,6'-spirobi[pyrido[1,2-c][1,2,3]benzoxaselenazin-7-ium] |
| SMILES | c1ccc2c(c1)O[Se]1(Oc3ccccc3-c3cccc[n+]31)[n+]1ccccc1-2 |
| InChI | InChI=1S/C22H16N2O2Se/c1-3-13-21-17(9-1)19-11-5-7-15-23(19)27(25-21)24-16-8-6-12-20(24)18-10-2-4-14-22(18)26-27/h1-16H/q+2 |
| InChIKey | GEKBZGLYZFFECQ-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 26.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.34 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|