C46H36N2 — CID 154591787
6,13-bis(9,9-dimethylfluoren-2-yl)-3,10-dimethyl-2,9-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(14),2,4(16),5,7,9,11(15),12-octaene (PubChem CID 154591787) has the molecular formula C46H36N2 and a molecular weight of 616.81 g/mol. Its IUPAC name is 6,13-bis(9,9-dimethylfluoren-2-yl)-3,10-dimethyl-2,9-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(14),2,4(16),5,7,9,11(15),12-octaene.
| Compound Name | 6,13-bis(9,9-dimethylfluoren-2-yl)-3,10-dimethyl-2,9-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(14),2,4(16),5,7,9,11(15),12-octaene |
|---|---|
| PubChem CID | 154591787 |
| Molecular Formula | C46H36N2 |
| Molecular Weight | 616.81 g/mol |
| Exact Mass | 616.29 |
| IUPAC Name | 6,13-bis(9,9-dimethylfluoren-2-yl)-3,10-dimethyl-2,9-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(14),2,4(16),5,7,9,11(15),12-octaene |
| SMILES | Cc1nc2cc(-c3ccc4c(c3)C(C)(C)c3ccccc3-4)cc3c(C)nc4cc(-c5ccc6c(c5)C(C)(C)c5ccccc5-6)cc1c4c23 |
| InChI | InChI=1S/C46H36N2/c1-25-35-19-29(27-15-17-33-31-11-7-9-13-37(31)45(3,4)39(33)21-27)24-42-43(35)44-36(26(2)48-42)20-30(23-41(44)47-25)28-16-18-34-32-12-8-10-14-38(32)46(5,6)40(34)22-28/h7-24H,1-6H3 |
| InChIKey | CQLGMZATSCVHJO-UHFFFAOYSA-N |
| XLogP | 11.94 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.81 |
| LogP ≤ 5 | 11.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|