C27H26F2O6S2 — CID 154594510
2-[4-(4-diphenylsulfoniophenoxy)cyclohexanecarbonyl]oxy-1,1-difluoroethanesulfonate (PubChem CID 154594510) has the molecular formula C27H26F2O6S2 and a molecular weight of 548.63 g/mol. Its IUPAC name is 2-[4-(4-diphenylsulfoniophenoxy)cyclohexanecarbonyl]oxy-1,1-difluoroethanesulfonate.
| Compound Name | 2-[4-(4-diphenylsulfoniophenoxy)cyclohexanecarbonyl]oxy-1,1-difluoroethanesulfonate |
|---|---|
| PubChem CID | 154594510 |
| Molecular Formula | C27H26F2O6S2 |
| Molecular Weight | 548.63 g/mol |
| Exact Mass | 548.11 |
| IUPAC Name | 2-[4-(4-diphenylsulfoniophenoxy)cyclohexanecarbonyl]oxy-1,1-difluoroethanesulfonate |
| SMILES | O=C(OCC(F)(F)S(=O)(=O)[O-])C1CCC(Oc2ccc([S+](c3ccccc3)c3ccccc3)cc2)CC1 |
| InChI | InChI=1S/C27H26F2O6S2/c28-27(29,37(31,32)33)19-34-26(30)20-11-13-21(14-12-20)35-22-15-17-25(18-16-22)36(23-7-3-1-4-8-23)24-9-5-2-6-10-24/h1-10,15-18,20-21H,11-14,19H2 |
| InChIKey | LANJUWAMFLEXCZ-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 92.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.63 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|