C46H31N3O — CID 154594887
1-[3-[3-[3-[2,6-bis(2,3,4,5,6-pentadeuteriophenyl)phenyl]-2H-benzimidazol-3-ium-2-id-1-yl]phenoxy]phenyl]isoquinoline (PubChem CID 154594887) has the molecular formula C46H31N3O and a molecular weight of 651.84 g/mol. Its IUPAC name is 1-[3-[3-[3-[2,6-bis(2,3,4,5,6-pentadeuteriophenyl)phenyl]-2H-benzimidazol-3-ium-2-id-1-yl]phenoxy]phenyl]isoquinoline.
| Compound Name | 1-[3-[3-[3-[2,6-bis(2,3,4,5,6-pentadeuteriophenyl)phenyl]-2H-benzimidazol-3-ium-2-id-1-yl]phenoxy]phenyl]isoquinoline |
|---|---|
| PubChem CID | 154594887 |
| Molecular Formula | C46H31N3O |
| Molecular Weight | 651.84 g/mol |
| Exact Mass | 651.31 |
| IUPAC Name | 1-[3-[3-[3-[2,6-bis(2,3,4,5,6-pentadeuteriophenyl)phenyl]-2H-benzimidazol-3-ium-2-id-1-yl]phenoxy]phenyl]isoquinoline |
| SMILES | [2H]c1c([2H])c([2H])c(-c2cccc(-c3c([2H])c([2H])c([2H])c([2H])c3[2H])c2-[n+]2[c-]n(-c3cccc(Oc4cccc(-c5nccc6ccccc56)c4)c3)c3ccccc32)c([2H])c1[2H] |
| InChI | InChI=1S/C46H31N3O/c1-3-14-33(15-4-1)41-24-13-25-42(34-16-5-2-6-17-34)46(41)49-32-48(43-26-9-10-27-44(43)49)37-20-12-22-39(31-37)50-38-21-11-19-36(30-38)45-40-23-8-7-18-35(40)28-29-47-45/h1-31H/i1D,2D,3D,4D,5D,6D,14D,15D,16D,17D |
| InChIKey | WKQWCRIBQGHJNE-CMXGOFMVSA-N |
| XLogP | 11.05 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 651.84 |
| LogP ≤ 5 | 11.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|