About US12358907, Example 129
US12358907, Example 129 (PubChem CID 154598005) has the molecular formula C28H24F2N4O2
and a molecular weight of 486.50 g/mol. Its IUPAC name is N-[(2R,3R,4S)-4-fluoro-1-[1-(4-fluorophenyl)indazol-5-yl]-4-methyl-5-oxo-2-phenylpyrrolidin-3-yl]cyclopropanecarboxamide.
Molecular Properties
| Compound Name | US12358907, Example 129 |
| PubChem CID | 154598005 |
| Molecular Formula | C28H24F2N4O2 |
| Molecular Weight | 486.50 g/mol |
| Exact Mass | 486.19 |
| IUPAC Name | N-[(2R,3R,4S)-4-fluoro-1-[1-(4-fluorophenyl)indazol-5-yl]-4-methyl-5-oxo-2-phenylpyrrolidin-3-yl]cyclopropanecarboxamide |
| SMILES | C[C@@]1([C@@H]([C@H](N(C1=O)C2=CC3=C(C=C2)N(N=C3)C4=CC=C(C=C4)F)C5=CC=CC=C5)NC(=O)C6CC6)F |
| InChI | InChI=1S/C28H24F2N4O2/c1-28(30)25(32-26(35)18-7-8-18)24(17-5-3-2-4-6-17)33(27(28)36)22-13-14-23-19(15-22)16-31-34(23)21-11-9-20(29)10-12-21/h2-6,9-16,18,24-25H,7-8H2,1H3,(H,32,35)/t24-,25-,28+/m1/s1 |
| InChIKey | SCXRNTZTLMRAFO-SKVJQKLOSA-N |
| XLogP | 4.40 |
| TPSA | 67.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | 841 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 486.50 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze US12358907, Example 129 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of US12358907, Example 129?
The IUPAC name of US12358907, Example 129 (CID 154598005) is N-[(2R,3R,4S)-4-fluoro-1-[1-(4-fluorophenyl)indazol-5-yl]-4-methyl-5-oxo-2-phenylpyrrolidin-3-yl]cyclopropanecarboxamide.
What is the SMILES notation for US12358907, Example 129?
The canonical SMILES for US12358907, Example 129 is C[C@@]1([C@@H]([C@H](N(C1=O)C2=CC3=C(C=C2)N(N=C3)C4=CC=C(C=C4)F)C5=CC=CC=C5)NC(=O)C6CC6)F.
What is the InChIKey of US12358907, Example 129?
The InChIKey is SCXRNTZTLMRAFO-SKVJQKLOSA-N. The full InChI is InChI=1S/C28H24F2N4O2/c1-28(30)25(32-26(35)18-7-8-18)24(17-5-3-2-4-6-17)33(27(28)36)22-13-14-23-19(15-22)16-31-34(23)21-11-9-20(29)10-12-21/h2-6,9-16,18,24-25H,7-8H2,1H3,(H,32,35)/t24-,25-,28+/m1/s1.
What are the key properties of US12358907, Example 129?
US12358907, Example 129 has a molecular weight of 486.50 g/mol, XLogP of 4.40, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for US12358907, Example 129 is sourced from PubChem (CID 154598005), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).