C31H27N5O — CID 154598655
cyclopropyl-[(3S)-3-[[2-[4-(1H-indol-5-yl)phenyl]-5-isocyanobenzimidazol-1-yl]methyl]pyrrolidin-1-yl]methanone (PubChem CID 154598655) has the molecular formula C31H27N5O and a molecular weight of 485.59 g/mol. Its IUPAC name is cyclopropyl-[(3S)-3-[[2-[4-(1H-indol-5-yl)phenyl]-5-isocyanobenzimidazol-1-yl]methyl]pyrrolidin-1-yl]methanone.
| Compound Name | cyclopropyl-[(3S)-3-[[2-[4-(1H-indol-5-yl)phenyl]-5-isocyanobenzimidazol-1-yl]methyl]pyrrolidin-1-yl]methanone |
|---|---|
| PubChem CID | 154598655 |
| Molecular Formula | C31H27N5O |
| Molecular Weight | 485.59 g/mol |
| Exact Mass | 485.22 |
| IUPAC Name | cyclopropyl-[(3S)-3-[[2-[4-(1H-indol-5-yl)phenyl]-5-isocyanobenzimidazol-1-yl]methyl]pyrrolidin-1-yl]methanone |
| SMILES | [C-]#[N+]c1ccc2c(c1)nc(-c1ccc(-c3ccc4[nH]ccc4c3)cc1)n2C[C@@H]1CCN(C(=O)C2CC2)C1 |
| InChI | InChI=1S/C31H27N5O/c1-32-26-9-11-29-28(17-26)34-30(36(29)19-20-13-15-35(18-20)31(37)23-6-7-23)22-4-2-21(3-5-22)24-8-10-27-25(16-24)12-14-33-27/h2-5,8-12,14,16-17,20,23,33H,6-7,13,15,18-19H2/t20-/m1/s1 |
| InChIKey | ISLDDPHZBOCVAE-HXUWFJFHSA-N |
| XLogP | 6.66 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.59 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|