C26H26N4O — CID 56944874
cyclopropyl-[3-[[2-[4-(1H-indol-5-yl)phenyl]imidazol-1-yl]methyl]pyrrolidin-1-yl]methanone (PubChem CID 56944874) has the molecular formula C26H26N4O and a molecular weight of 410.52 g/mol. Its IUPAC name is cyclopropyl-[3-[[2-[4-(1H-indol-5-yl)phenyl]imidazol-1-yl]methyl]pyrrolidin-1-yl]methanone.
| Compound Name | cyclopropyl-[3-[[2-[4-(1H-indol-5-yl)phenyl]imidazol-1-yl]methyl]pyrrolidin-1-yl]methanone |
|---|---|
| PubChem CID | 56944874 |
| Molecular Formula | C26H26N4O |
| Molecular Weight | 410.52 g/mol |
| Exact Mass | 410.21 |
| IUPAC Name | cyclopropyl-[3-[[2-[4-(1H-indol-5-yl)phenyl]imidazol-1-yl]methyl]pyrrolidin-1-yl]methanone |
| SMILES | O=C(C1CC1)N1CCC(Cn2ccnc2-c2ccc(-c3ccc4[nH]ccc4c3)cc2)C1 |
| InChI | InChI=1S/C26H26N4O/c31-26(21-5-6-21)30-13-10-18(17-30)16-29-14-12-28-25(29)20-3-1-19(2-4-20)22-7-8-24-23(15-22)9-11-27-24/h1-4,7-9,11-12,14-15,18,21,27H,5-6,10,13,16-17H2 |
| InChIKey | ISOLRJPLVCEBPJ-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 53.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.52 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |