C41H23N11 — CID 154599067
6-[4-[4-anthracen-1-yl-6-[4-(1,2,3,4-benzotetrazin-6-yl)phenyl]-1,3,5-triazin-2-yl]phenyl]-1,2,3,4-benzotetrazine (PubChem CID 154599067) has the molecular formula C41H23N11 and a molecular weight of 669.71 g/mol. Its IUPAC name is 6-[4-[4-anthracen-1-yl-6-[4-(1,2,3,4-benzotetrazin-6-yl)phenyl]-1,3,5-triazin-2-yl]phenyl]-1,2,3,4-benzotetrazine.
| Compound Name | 6-[4-[4-anthracen-1-yl-6-[4-(1,2,3,4-benzotetrazin-6-yl)phenyl]-1,3,5-triazin-2-yl]phenyl]-1,2,3,4-benzotetrazine |
|---|---|
| PubChem CID | 154599067 |
| Molecular Formula | C41H23N11 |
| Molecular Weight | 669.71 g/mol |
| Exact Mass | 669.21 |
| IUPAC Name | 6-[4-[4-anthracen-1-yl-6-[4-(1,2,3,4-benzotetrazin-6-yl)phenyl]-1,3,5-triazin-2-yl]phenyl]-1,2,3,4-benzotetrazine |
| SMILES | c1ccc2cc3c(-c4nc(-c5ccc(-c6ccc7nnnnc7c6)cc5)nc(-c5ccc(-c6ccc7nnnnc7c6)cc5)n4)cccc3cc2c1 |
| InChI | InChI=1S/C41H23N11/c1-2-5-29-21-34-32(20-28(29)4-1)6-3-7-33(34)41-43-39(26-12-8-24(9-13-26)30-16-18-35-37(22-30)47-51-49-45-35)42-40(44-41)27-14-10-25(11-15-27)31-17-19-36-38(23-31)48-52-50-46-36/h1-23H |
| InChIKey | ISQYCXUEQUAANB-UHFFFAOYSA-N |
| XLogP | 7.98 |
| TPSA | 141.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 52 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 669.71 |
| LogP ≤ 5 | 7.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|