C54H32N6O — CID 154600188
19-[3-[4,6-bis(4-pyridin-4-ylphenyl)-1,3,5-triazin-2-yl]phenyl]-23-oxa-20-azahexacyclo[12.11.0.02,7.08,13.016,24.017,22]pentacosa-1(25),2,4,6,8,10,12,14,16(24),17,19,21-dodecaene (PubChem CID 154600188) has the molecular formula C54H32N6O and a molecular weight of 780.89 g/mol. Its IUPAC name is 19-[3-[4,6-bis(4-pyridin-4-ylphenyl)-1,3,5-triazin-2-yl]phenyl]-23-oxa-20-azahexacyclo[12.11.0.02,7.08,13.016,24.017,22]pentacosa-1(25),2,4,6,8,10,12,14,16(24),17,19,21-dodecaene.
| Compound Name | 19-[3-[4,6-bis(4-pyridin-4-ylphenyl)-1,3,5-triazin-2-yl]phenyl]-23-oxa-20-azahexacyclo[12.11.0.02,7.08,13.016,24.017,22]pentacosa-1(25),2,4,6,8,10,12,14,16(24),17,19,21-dodecaene |
|---|---|
| PubChem CID | 154600188 |
| Molecular Formula | C54H32N6O |
| Molecular Weight | 780.89 g/mol |
| Exact Mass | 780.26 |
| IUPAC Name | 19-[3-[4,6-bis(4-pyridin-4-ylphenyl)-1,3,5-triazin-2-yl]phenyl]-23-oxa-20-azahexacyclo[12.11.0.02,7.08,13.016,24.017,22]pentacosa-1(25),2,4,6,8,10,12,14,16(24),17,19,21-dodecaene |
| SMILES | c1cc(-c2cc3c(cn2)oc2cc4c5ccccc5c5ccccc5c4cc23)cc(-c2nc(-c3ccc(-c4ccncc4)cc3)nc(-c3ccc(-c4ccncc4)cc3)n2)c1 |
| InChI | InChI=1S/C54H32N6O/c1-3-10-43-41(8-1)42-9-2-4-11-44(42)46-31-50-47(29-45(43)46)48-30-49(57-32-51(48)61-50)39-6-5-7-40(28-39)54-59-52(37-16-12-33(13-17-37)35-20-24-55-25-21-35)58-53(60-54)38-18-14-34(15-19-38)36-22-26-56-27-23-36/h1-32H |
| InChIKey | VPNMOHVJFUVUPP-UHFFFAOYSA-N |
| XLogP | 13.42 |
| TPSA | 90.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 780.89 |
| LogP ≤ 5 | 13.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|