C47H29N5O — CID 147101009
13-[4-[3-[4-phenyl-6-(4-phenylphenyl)-1,3,5-triazin-2-yl]phenyl]phenyl]-17-oxa-8,14-diazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),2,4,6,8,11,13,15-octaene (PubChem CID 147101009) has the molecular formula C47H29N5O and a molecular weight of 679.78 g/mol. Its IUPAC name is 13-[4-[3-[4-phenyl-6-(4-phenylphenyl)-1,3,5-triazin-2-yl]phenyl]phenyl]-17-oxa-8,14-diazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),2,4,6,8,11,13,15-octaene.
| Compound Name | 13-[4-[3-[4-phenyl-6-(4-phenylphenyl)-1,3,5-triazin-2-yl]phenyl]phenyl]-17-oxa-8,14-diazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),2,4,6,8,11,13,15-octaene |
|---|---|
| PubChem CID | 147101009 |
| Molecular Formula | C47H29N5O |
| Molecular Weight | 679.78 g/mol |
| Exact Mass | 679.24 |
| IUPAC Name | 13-[4-[3-[4-phenyl-6-(4-phenylphenyl)-1,3,5-triazin-2-yl]phenyl]phenyl]-17-oxa-8,14-diazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),2,4,6,8,11,13,15-octaene |
| SMILES | c1ccc(-c2ccc(-c3nc(-c4ccccc4)nc(-c4cccc(-c5ccc(-c6cc7c(cn6)oc6c8ccccc8ncc76)cc5)c4)n3)cc2)cc1 |
| InChI | InChI=1S/C47H29N5O/c1-3-10-30(11-4-1)31-20-24-35(25-21-31)46-50-45(34-12-5-2-6-13-34)51-47(52-46)37-15-9-14-36(26-37)32-18-22-33(23-19-32)42-27-39-40-28-48-41-17-8-7-16-38(41)44(40)53-43(39)29-49-42/h1-29H |
| InChIKey | BKQRDFVBQQHUOC-UHFFFAOYSA-N |
| XLogP | 11.72 |
| TPSA | 77.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 679.78 |
| LogP ≤ 5 | 11.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |