C40H24N6O — CID 168745980
12-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-5-quinolin-2-yl-8-oxa-4,11-diazatricyclo[7.4.0.02,7]trideca-1(13),2,4,6,9,11-hexaene (PubChem CID 168745980) has the molecular formula C40H24N6O and a molecular weight of 604.67 g/mol. Its IUPAC name is 12-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-5-quinolin-2-yl-8-oxa-4,11-diazatricyclo[7.4.0.02,7]trideca-1(13),2,4,6,9,11-hexaene.
| Compound Name | 12-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-5-quinolin-2-yl-8-oxa-4,11-diazatricyclo[7.4.0.02,7]trideca-1(13),2,4,6,9,11-hexaene |
|---|---|
| PubChem CID | 168745980 |
| Molecular Formula | C40H24N6O |
| Molecular Weight | 604.67 g/mol |
| Exact Mass | 604.20 |
| IUPAC Name | 12-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-5-quinolin-2-yl-8-oxa-4,11-diazatricyclo[7.4.0.02,7]trideca-1(13),2,4,6,9,11-hexaene |
| SMILES | c1ccc(-c2nc(-c3ccccc3)nc(-c3cccc(-c4cc5c(cn4)oc4cc(-c6ccc7ccccc7n6)ncc45)c3)n2)cc1 |
| InChI | InChI=1S/C40H24N6O/c1-3-11-26(12-4-1)38-44-39(27-13-5-2-6-14-27)46-40(45-38)29-16-9-15-28(20-29)34-21-30-31-23-41-35(22-36(31)47-37(30)24-42-34)33-19-18-25-10-7-8-17-32(25)43-33/h1-24H |
| InChIKey | IXWFKFKSAVLWFY-UHFFFAOYSA-N |
| XLogP | 9.44 |
| TPSA | 90.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.67 |
| LogP ≤ 5 | 9.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |