C22H22F2N4O3S — CID 154601210
[(2R,3S)-5-amino-3-[2-fluoro-5-[(Z)-2-fluoro-2-(5-isocyano-2-pyridinyl)ethenyl]phenyl]-2,6,6-trimethyl-1,1-dioxo-2H-1,4-thiazin-3-yl]methanol (PubChem CID 154601210) has the molecular formula C22H22F2N4O3S and a molecular weight of 460.51 g/mol. Its IUPAC name is [(2R,3S)-5-amino-3-[2-fluoro-5-[(Z)-2-fluoro-2-(5-isocyano-2-pyridinyl)ethenyl]phenyl]-2,6,6-trimethyl-1,1-dioxo-2H-1,4-thiazin-3-yl]methanol.
| Compound Name | [(2R,3S)-5-amino-3-[2-fluoro-5-[(Z)-2-fluoro-2-(5-isocyano-2-pyridinyl)ethenyl]phenyl]-2,6,6-trimethyl-1,1-dioxo-2H-1,4-thiazin-3-yl]methanol |
|---|---|
| PubChem CID | 154601210 |
| Molecular Formula | C22H22F2N4O3S |
| Molecular Weight | 460.51 g/mol |
| Exact Mass | 460.14 |
| IUPAC Name | [(2R,3S)-5-amino-3-[2-fluoro-5-[(Z)-2-fluoro-2-(5-isocyano-2-pyridinyl)ethenyl]phenyl]-2,6,6-trimethyl-1,1-dioxo-2H-1,4-thiazin-3-yl]methanol |
| SMILES | [C-]#[N+]c1ccc(/C(F)=C/c2ccc(F)c([C@@]3(CO)N=C(N)C(C)(C)S(=O)(=O)[C@@H]3C)c2)nc1 |
| InChI | InChI=1S/C22H22F2N4O3S/c1-13-22(12-29,28-20(25)21(2,3)32(13,30)31)16-9-14(5-7-17(16)23)10-18(24)19-8-6-15(26-4)11-27-19/h5-11,13,29H,12H2,1-3H3,(H2,25,28)/b18-10-/t13-,22+/m1/s1 |
| InChIKey | QAASCWARZNGYOD-UKCAQPNUSA-N |
| XLogP | 3.38 |
| TPSA | 110.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.51 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|