C76H48N6 — CID 154603106
9-[3-[2-(3,6-diphenylcarbazol-9-yl)-5-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-4-isocyanophenyl]-3,6-diphenylcarbazole (PubChem CID 154603106) has the molecular formula C76H48N6 and a molecular weight of 1045.26 g/mol. Its IUPAC name is 9-[3-[2-(3,6-diphenylcarbazol-9-yl)-5-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-4-isocyanophenyl]-3,6-diphenylcarbazole.
| Compound Name | 9-[3-[2-(3,6-diphenylcarbazol-9-yl)-5-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-4-isocyanophenyl]-3,6-diphenylcarbazole |
|---|---|
| PubChem CID | 154603106 |
| Molecular Formula | C76H48N6 |
| Molecular Weight | 1045.26 g/mol |
| Exact Mass | 1044.39 |
| IUPAC Name | 9-[3-[2-(3,6-diphenylcarbazol-9-yl)-5-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-4-isocyanophenyl]-3,6-diphenylcarbazole |
| SMILES | [C-]#[N+]c1ccc(-n2c3ccc(-c4ccccc4)cc3c3cc(-c4ccccc4)ccc32)cc1-c1cc(-c2nc(-c3ccccc3)nc(-c3ccccc3)n2)ccc1-n1c2ccc(-c3ccccc3)cc2c2cc(-c3ccccc3)ccc21 |
| InChI | InChI=1S/C76H48N6/c1-77-68-38-37-61(81-69-39-32-56(50-20-8-2-9-21-50)44-64(69)65-45-57(33-40-70(65)81)51-22-10-3-11-23-51)49-62(68)63-48-60(76-79-74(54-28-16-6-17-29-54)78-75(80-76)55-30-18-7-19-31-55)36-43-71(63)82-72-41-34-58(52-24-12-4-13-25-52)46-66(72)67-47-59(35-42-73(67)82)53-26-14-5-15-27-53/h2-49H |
| InChIKey | FKDPOSUWDHWAGM-UHFFFAOYSA-N |
| XLogP | 19.95 |
| TPSA | 52.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 82 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1045.26 |
| LogP ≤ 5 | 19.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|