C28H32F2Zr — CID 154603991
difluorozirconium(2+);2-methyl-4-phenyl-1H-inden-1-ide;1,2,3,5-tetramethyl-4-propylcyclopenta-1,3-diene (PubChem CID 154603991) has the molecular formula C28H32F2Zr and a molecular weight of 497.78 g/mol. Its IUPAC name is difluorozirconium(2+);2-methyl-4-phenyl-1H-inden-1-ide;1,2,3,5-tetramethyl-4-propylcyclopenta-1,3-diene.
| Compound Name | difluorozirconium(2+);2-methyl-4-phenyl-1H-inden-1-ide;1,2,3,5-tetramethyl-4-propylcyclopenta-1,3-diene |
|---|---|
| PubChem CID | 154603991 |
| Molecular Formula | C28H32F2Zr |
| Molecular Weight | 497.78 g/mol |
| Exact Mass | 496.15 |
| IUPAC Name | difluorozirconium(2+);2-methyl-4-phenyl-1H-inden-1-ide;1,2,3,5-tetramethyl-4-propylcyclopenta-1,3-diene |
| SMILES | CCCc1c(C)c(C)c(C)[c-]1C.Cc1cc2c(-c3ccccc3)cccc2[cH-]1.F[Zr+2]F |
| InChI | InChI=1S/C16H13.C12H19.2FH.Zr/c1-12-10-14-8-5-9-15(16(14)11-12)13-6-3-2-4-7-13;1-6-7-12-10(4)8(2)9(3)11(12)5;;;/h2-11H,1H3;6-7H2,1-5H3;2*1H;/q2*-1;;;+4/p-2 |
| InChIKey | ANWXCWFYBKSKND-UHFFFAOYSA-L |
| XLogP | 8.96 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.78 |
| LogP ≤ 5 | 8.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|