C22H12N4OS — CID 154604929
3-[3-(1,3-benzothiazol-6-yl)-7-oxo-8H-1,8-naphthyridin-2-yl]benzonitrile (PubChem CID 154604929) has the molecular formula C22H12N4OS and a molecular weight of 380.43 g/mol. Its IUPAC name is 3-[3-(1,3-benzothiazol-6-yl)-7-oxo-8H-1,8-naphthyridin-2-yl]benzonitrile.
| Compound Name | 3-[3-(1,3-benzothiazol-6-yl)-7-oxo-8H-1,8-naphthyridin-2-yl]benzonitrile |
|---|---|
| PubChem CID | 154604929 |
| Molecular Formula | C22H12N4OS |
| Molecular Weight | 380.43 g/mol |
| Exact Mass | 380.07 |
| IUPAC Name | 3-[3-(1,3-benzothiazol-6-yl)-7-oxo-8H-1,8-naphthyridin-2-yl]benzonitrile |
| SMILES | N#Cc1cccc(-c2nc3[nH]c(=O)ccc3cc2-c2ccc3ncsc3c2)c1 |
| InChI | InChI=1S/C22H12N4OS/c23-11-13-2-1-3-15(8-13)21-17(9-16-5-7-20(27)25-22(16)26-21)14-4-6-18-19(10-14)28-12-24-18/h1-10,12H,(H,25,26,27) |
| InChIKey | WWFXTEQIGMVJDN-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 82.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.43 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |