About phosphanium (3-butylphenyl)-triphenylboranuide
phosphanium (3-butylphenyl)-triphenylboranuide (PubChem CID 154605445) has the molecular formula C28H32BP
and a molecular weight of 410.35 g/mol. Its IUPAC name is phosphanium (3-butylphenyl)-triphenylboranuide.
Molecular Properties
| Compound Name | phosphanium (3-butylphenyl)-triphenylboranuide |
| PubChem CID | 154605445 |
| Molecular Formula | C28H32BP |
| Molecular Weight | 410.35 g/mol |
| Exact Mass | 410.23 |
| IUPAC Name | phosphanium (3-butylphenyl)-triphenylboranuide |
| SMILES | CCCCc1cccc([B-](c2ccccc2)(c2ccccc2)c2ccccc2)c1.[PH4+] |
| InChI | InChI=1S/C28H28B.H3P/c1-2-3-14-24-15-13-22-28(23-24)29(25-16-7-4-8-17-25,26-18-9-5-10-19-26)27-20-11-6-12-21-27;/h4-13,15-23H,2-3,14H2,1H3;1H3/q-1;/p+1 |
| InChIKey | VIPMWDCNCMZWSV-UHFFFAOYSA-O |
| XLogP | 4.20 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 410.35 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze phosphanium (3-butylphenyl)-triphenylboranuide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of phosphanium (3-butylphenyl)-triphenylboranuide?
The IUPAC name of phosphanium (3-butylphenyl)-triphenylboranuide (CID 154605445) is phosphanium (3-butylphenyl)-triphenylboranuide.
What is the SMILES notation for phosphanium (3-butylphenyl)-triphenylboranuide?
The canonical SMILES for phosphanium (3-butylphenyl)-triphenylboranuide is CCCCc1cccc([B-](c2ccccc2)(c2ccccc2)c2ccccc2)c1.[PH4+].
What is the InChIKey of phosphanium (3-butylphenyl)-triphenylboranuide?
The InChIKey is VIPMWDCNCMZWSV-UHFFFAOYSA-O. The full InChI is InChI=1S/C28H28B.H3P/c1-2-3-14-24-15-13-22-28(23-24)29(25-16-7-4-8-17-25,26-18-9-5-10-19-26)27-20-11-6-12-21-27;/h4-13,15-23H,2-3,14H2,1H3;1H3/q-1;/p+1.
What are the key properties of phosphanium (3-butylphenyl)-triphenylboranuide?
phosphanium (3-butylphenyl)-triphenylboranuide has a molecular weight of 410.35 g/mol, XLogP of 4.20, 7 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for phosphanium (3-butylphenyl)-triphenylboranuide is sourced from PubChem (CID 154605445), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).