C10H6F2IO4- — CID 154609349
2,3-difluoro-4-(2-iodopropanoyloxy)benzoate (PubChem CID 154609349) has the molecular formula C10H6F2IO4- and a molecular weight of 355.05 g/mol. Its IUPAC name is 2,3-difluoro-4-(2-iodopropanoyloxy)benzoate.
| Compound Name | 2,3-difluoro-4-(2-iodopropanoyloxy)benzoate |
|---|---|
| PubChem CID | 154609349 |
| Molecular Formula | C10H6F2IO4- |
| Molecular Weight | 355.05 g/mol |
| Exact Mass | 354.93 |
| IUPAC Name | 2,3-difluoro-4-(2-iodopropanoyloxy)benzoate |
| SMILES | CC(I)C(=O)Oc1ccc(C(=O)[O-])c(F)c1F |
| InChI | InChI=1S/C10H7F2IO4/c1-4(13)10(16)17-6-3-2-5(9(14)15)7(11)8(6)12/h2-4H,1H3,(H,14,15)/p-1 |
| InChIKey | KZJQKLPQFIRFAI-UHFFFAOYSA-M |
| XLogP | 1.06 |
| TPSA | 66.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.05 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|