About 2-fluoro-3-iodobenzoate
2-fluoro-3-iodobenzoate (PubChem CID 34174491) has the molecular formula C7H3FIO2-
and a molecular weight of 265.00 g/mol. Its IUPAC name is 2-fluoro-3-iodobenzoate.
Molecular Properties
| Compound Name | 2-fluoro-3-iodobenzoate |
| PubChem CID | 34174491 |
| Molecular Formula | C7H3FIO2- |
| Molecular Weight | 265.00 g/mol |
| Exact Mass | 264.92 |
| IUPAC Name | 2-fluoro-3-iodobenzoate |
| SMILES | O=C([O-])c1cccc(I)c1F |
| InChI | InChI=1S/C7H4FIO2/c8-6-4(7(10)11)2-1-3-5(6)9/h1-3H,(H,10,11)/p-1 |
| InChIKey | FVLHWICBHZCKED-UHFFFAOYSA-M |
| XLogP | 0.79 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.00 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 2-fluoro-3-iodobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-fluoro-3-iodobenzoate?
The IUPAC name of 2-fluoro-3-iodobenzoate (CID 34174491) is 2-fluoro-3-iodobenzoate.
What is the SMILES notation for 2-fluoro-3-iodobenzoate?
The canonical SMILES for 2-fluoro-3-iodobenzoate is O=C([O-])c1cccc(I)c1F.
What is the InChIKey of 2-fluoro-3-iodobenzoate?
The InChIKey is FVLHWICBHZCKED-UHFFFAOYSA-M. The full InChI is InChI=1S/C7H4FIO2/c8-6-4(7(10)11)2-1-3-5(6)9/h1-3H,(H,10,11)/p-1.
What are the key properties of 2-fluoro-3-iodobenzoate?
2-fluoro-3-iodobenzoate has a molecular weight of 265.00 g/mol, XLogP of 0.79, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-fluoro-3-iodobenzoate is sourced from PubChem (CID 34174491), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).