C19H16N6O4 — CID 154610169
3-amino-5-[3-ethoxy-4-(7-oxo-2,6-dihydrotriazolo[4,5-d]pyrimidin-5-yl)phenyl]benzoic acid (PubChem CID 154610169) has the molecular formula C19H16N6O4 and a molecular weight of 392.38 g/mol. Its IUPAC name is 3-amino-5-[3-ethoxy-4-(7-oxo-2,6-dihydrotriazolo[4,5-d]pyrimidin-5-yl)phenyl]benzoic acid.
| Compound Name | 3-amino-5-[3-ethoxy-4-(7-oxo-2,6-dihydrotriazolo[4,5-d]pyrimidin-5-yl)phenyl]benzoic acid |
|---|---|
| PubChem CID | 154610169 |
| Molecular Formula | C19H16N6O4 |
| Molecular Weight | 392.38 g/mol |
| Exact Mass | 392.12 |
| IUPAC Name | 3-amino-5-[3-ethoxy-4-(7-oxo-2,6-dihydrotriazolo[4,5-d]pyrimidin-5-yl)phenyl]benzoic acid |
| SMILES | CCOc1cc(-c2cc(N)cc(C(=O)O)c2)ccc1-c1nc2n[nH]nc2c(=O)[nH]1 |
| InChI | InChI=1S/C19H16N6O4/c1-2-29-14-8-9(10-5-11(19(27)28)7-12(20)6-10)3-4-13(14)16-21-17-15(18(26)22-16)23-25-24-17/h3-8H,2,20H2,1H3,(H,27,28)(H2,21,22,23,24,25,26) |
| InChIKey | YKHKHVOYRMJNAO-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 159.87 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.38 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|