C20H16F3N5O4 — CID 168747356
5-[2-ethoxy-4-[4-(2,2,2-trifluoro-1,1-dihydroxyethyl)phenyl]phenyl]-2,6-dihydrotriazolo[4,5-d]pyrimidin-7-one (PubChem CID 168747356) has the molecular formula C20H16F3N5O4 and a molecular weight of 447.37 g/mol. Its IUPAC name is 5-[2-ethoxy-4-[4-(2,2,2-trifluoro-1,1-dihydroxyethyl)phenyl]phenyl]-2,6-dihydrotriazolo[4,5-d]pyrimidin-7-one.
| Compound Name | 5-[2-ethoxy-4-[4-(2,2,2-trifluoro-1,1-dihydroxyethyl)phenyl]phenyl]-2,6-dihydrotriazolo[4,5-d]pyrimidin-7-one |
|---|---|
| PubChem CID | 168747356 |
| Molecular Formula | C20H16F3N5O4 |
| Molecular Weight | 447.37 g/mol |
| Exact Mass | 447.12 |
| IUPAC Name | 5-[2-ethoxy-4-[4-(2,2,2-trifluoro-1,1-dihydroxyethyl)phenyl]phenyl]-2,6-dihydrotriazolo[4,5-d]pyrimidin-7-one |
| SMILES | CCOc1cc(-c2ccc(C(O)(O)C(F)(F)F)cc2)ccc1-c1nc2n[nH]nc2c(=O)[nH]1 |
| InChI | InChI=1S/C20H16F3N5O4/c1-2-32-14-9-11(10-3-6-12(7-4-10)19(30,31)20(21,22)23)5-8-13(14)16-24-17-15(18(29)25-16)26-28-27-17/h3-9,30-31H,2H2,1H3,(H2,24,25,26,27,28,29) |
| InChIKey | ZPTKFWJXOWQTQE-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 137.01 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.37 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|