About CID 154610598
CID 154610598 (PubChem CID 154610598) has the molecular formula C40H22N6OPt
and a molecular weight of 797.74 g/mol.
Molecular Properties
| Compound Name | CID 154610598 |
| PubChem CID | 154610598 |
| Molecular Formula | C40H22N6OPt |
| Molecular Weight | 797.74 g/mol |
| Exact Mass | 797.15 |
| IUPAC Name | — |
| SMILES | [Pt+2].[c-]1c(Oc2[c-]c3c(cc2)c2ccc(-c4ccccc4)cc2n2c(-c4ccccc4)cnc32)ccc2c1c1nccn1c1nccnc21 |
| InChI | InChI=1S/C40H22N6O.Pt/c1-3-7-25(8-4-1)27-11-14-31-30-15-12-28(22-33(30)39-44-24-36(46(39)35(31)21-27)26-9-5-2-6-10-26)47-29-13-16-32-34(23-29)38-43-19-20-45(38)40-37(32)41-17-18-42-40;/h1-21,24H;/q-2;+2 |
| InChIKey | RLLFEJVFPZJJPF-UHFFFAOYSA-N |
| XLogP | 9.11 |
| TPSA | 69.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 48 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 797.74 |
| LogP ≤ 5 | 9.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze CID 154610598 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 154610598?
The IUPAC name of CID 154610598 (CID 154610598) is not available.
What is the SMILES notation for CID 154610598?
The canonical SMILES for CID 154610598 is [Pt+2].[c-]1c(Oc2[c-]c3c(cc2)c2ccc(-c4ccccc4)cc2n2c(-c4ccccc4)cnc32)ccc2c1c1nccn1c1nccnc21.
What is the InChIKey of CID 154610598?
The InChIKey is RLLFEJVFPZJJPF-UHFFFAOYSA-N. The full InChI is InChI=1S/C40H22N6O.Pt/c1-3-7-25(8-4-1)27-11-14-31-30-15-12-28(22-33(30)39-44-24-36(46(39)35(31)21-27)26-9-5-2-6-10-26)47-29-13-16-32-34(23-29)38-43-19-20-45(38)40-37(32)41-17-18-42-40;/h1-21,24H;/q-2;+2.
What are the key properties of CID 154610598?
CID 154610598 has a molecular weight of 797.74 g/mol, XLogP of 9.11, 4 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for CID 154610598 is sourced from PubChem (CID 154610598), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).