C21H18FN3O4S — CID 154613111
N-[3-(4-fluorophenyl)propyl]-4,10,10-trioxo-5H-pyrrolo[1,2-b][1,2,5]benzothiadiazepine-7-carboxamide (PubChem CID 154613111) has the molecular formula C21H18FN3O4S and a molecular weight of 427.46 g/mol. Its IUPAC name is N-[3-(4-fluorophenyl)propyl]-4,10,10-trioxo-5H-pyrrolo[1,2-b][1,2,5]benzothiadiazepine-7-carboxamide.
| Compound Name | N-[3-(4-fluorophenyl)propyl]-4,10,10-trioxo-5H-pyrrolo[1,2-b][1,2,5]benzothiadiazepine-7-carboxamide |
|---|---|
| PubChem CID | 154613111 |
| Molecular Formula | C21H18FN3O4S |
| Molecular Weight | 427.46 g/mol |
| Exact Mass | 427.10 |
| IUPAC Name | N-[3-(4-fluorophenyl)propyl]-4,10,10-trioxo-5H-pyrrolo[1,2-b][1,2,5]benzothiadiazepine-7-carboxamide |
| SMILES | O=C(NCCCc1ccc(F)cc1)c1ccc2c(c1)NC(=O)c1cccn1S2(=O)=O |
| InChI | InChI=1S/C21H18FN3O4S/c22-16-8-5-14(6-9-16)3-1-11-23-20(26)15-7-10-19-17(13-15)24-21(27)18-4-2-12-25(18)30(19,28)29/h2,4-10,12-13H,1,3,11H2,(H,23,26)(H,24,27) |
| InChIKey | DVGPPQKIZMUDMU-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 97.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.46 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|