C19H13ClFN5O2 — CID 154614418
N-[4-[[5-(5-chloro-2-fluorophenyl)-2-isocyano-6-oxo-1H-pyridin-3-yl]amino]-2-pyridinyl]acetamide (PubChem CID 154614418) has the molecular formula C19H13ClFN5O2 and a molecular weight of 397.80 g/mol. Its IUPAC name is N-[4-[[5-(5-chloro-2-fluorophenyl)-2-isocyano-6-oxo-1H-pyridin-3-yl]amino]-2-pyridinyl]acetamide.
| Compound Name | N-[4-[[5-(5-chloro-2-fluorophenyl)-2-isocyano-6-oxo-1H-pyridin-3-yl]amino]-2-pyridinyl]acetamide |
|---|---|
| PubChem CID | 154614418 |
| Molecular Formula | C19H13ClFN5O2 |
| Molecular Weight | 397.80 g/mol |
| Exact Mass | 397.07 |
| IUPAC Name | N-[4-[[5-(5-chloro-2-fluorophenyl)-2-isocyano-6-oxo-1H-pyridin-3-yl]amino]-2-pyridinyl]acetamide |
| SMILES | [C-]#[N+]c1[nH]c(=O)c(-c2cc(Cl)ccc2F)cc1Nc1ccnc(NC(C)=O)c1 |
| InChI | InChI=1S/C19H13ClFN5O2/c1-10(27)24-17-8-12(5-6-23-17)25-16-9-14(19(28)26-18(16)22-2)13-7-11(20)3-4-15(13)21/h3-9H,1H3,(H,26,28)(H2,23,24,25,27) |
| InChIKey | BWAMXIJKGILUMG-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 91.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.80 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|