C19H16ClFN4O3 — CID 146296471
3-(5-chloro-2-fluorophenyl)-5-[(2-nitro-4-pyridinyl)amino]-6-propan-2-yl-1H-pyridin-2-one (PubChem CID 146296471) has the molecular formula C19H16ClFN4O3 and a molecular weight of 402.81 g/mol. Its IUPAC name is 3-(5-chloro-2-fluorophenyl)-5-[(2-nitro-4-pyridinyl)amino]-6-propan-2-yl-1H-pyridin-2-one.
| Compound Name | 3-(5-chloro-2-fluorophenyl)-5-[(2-nitro-4-pyridinyl)amino]-6-propan-2-yl-1H-pyridin-2-one |
|---|---|
| PubChem CID | 146296471 |
| Molecular Formula | C19H16ClFN4O3 |
| Molecular Weight | 402.81 g/mol |
| Exact Mass | 402.09 |
| IUPAC Name | 3-(5-chloro-2-fluorophenyl)-5-[(2-nitro-4-pyridinyl)amino]-6-propan-2-yl-1H-pyridin-2-one |
| SMILES | CC(C)c1[nH]c(=O)c(-c2cc(Cl)ccc2F)cc1Nc1ccnc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C19H16ClFN4O3/c1-10(2)18-16(23-12-5-6-22-17(8-12)25(27)28)9-14(19(26)24-18)13-7-11(20)3-4-15(13)21/h3-10H,1-2H3,(H,22,23)(H,24,26) |
| InChIKey | PTAPPDLLEYEHQL-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 100.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.81 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|