About 4-chloro-2-nitropyridine
4-chloro-2-nitropyridine (PubChem CID 2762847) has the molecular formula C5H3ClN2O2
and a molecular weight of 158.54 g/mol. Its IUPAC name is 4-chloro-2-nitropyridine.
Molecular Properties
| Compound Name | 4-chloro-2-nitropyridine |
| PubChem CID | 2762847 |
| Molecular Formula | C5H3ClN2O2 |
| Molecular Weight | 158.54 g/mol |
| Exact Mass | 157.99 |
| IUPAC Name | 4-chloro-2-nitropyridine |
| SMILES | O=[N+]([O-])c1cc(Cl)ccn1 |
| InChI | InChI=1S/C5H3ClN2O2/c6-4-1-2-7-5(3-4)8(9)10/h1-3H |
| InChIKey | YPKBJRKFGYVURL-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 56.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.54 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-chloro-2-nitropyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-2-nitropyridine?
The IUPAC name of 4-chloro-2-nitropyridine (CID 2762847) is 4-chloro-2-nitropyridine.
What is the SMILES notation for 4-chloro-2-nitropyridine?
The canonical SMILES for 4-chloro-2-nitropyridine is O=[N+]([O-])c1cc(Cl)ccn1.
What is the InChIKey of 4-chloro-2-nitropyridine?
The InChIKey is YPKBJRKFGYVURL-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H3ClN2O2/c6-4-1-2-7-5(3-4)8(9)10/h1-3H.
What are the key properties of 4-chloro-2-nitropyridine?
4-chloro-2-nitropyridine has a molecular weight of 158.54 g/mol, XLogP of 1.64, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-2-nitropyridine is sourced from PubChem (CID 2762847), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).