About 8-fluoro-2,9,9-trimethyl-1-(1-methylpyridin-1-ium-2-yl)fluorene-4-carbonitrile
8-fluoro-2,9,9-trimethyl-1-(1-methylpyridin-1-ium-2-yl)fluorene-4-carbonitrile (PubChem CID 154615164) has the molecular formula C23H20FN2+
and a molecular weight of 343.43 g/mol. Its IUPAC name is 8-fluoro-2,9,9-trimethyl-1-(1-methylpyridin-1-ium-2-yl)fluorene-4-carbonitrile.
Molecular Properties
| Compound Name | 8-fluoro-2,9,9-trimethyl-1-(1-methylpyridin-1-ium-2-yl)fluorene-4-carbonitrile |
| PubChem CID | 154615164 |
| Molecular Formula | C23H20FN2+ |
| Molecular Weight | 343.43 g/mol |
| Exact Mass | 343.16 |
| IUPAC Name | 8-fluoro-2,9,9-trimethyl-1-(1-methylpyridin-1-ium-2-yl)fluorene-4-carbonitrile |
| SMILES | Cc1cc(C#N)c2c(c1-c1cccc[n+]1C)C(C)(C)c1c(F)cccc1-2 |
| InChI | InChI=1S/C23H20FN2/c1-14-12-15(13-25)20-16-8-7-9-17(24)21(16)23(2,3)22(20)19(14)18-10-5-6-11-26(18)4/h5-12H,1-4H3/q+1 |
| InChIKey | WUEWAUPEQQZOEY-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 27.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 343.43 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 8-fluoro-2,9,9-trimethyl-1-(1-methylpyridin-1-ium-2-yl)fluorene-4-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-fluoro-2,9,9-trimethyl-1-(1-methylpyridin-1-ium-2-yl)fluorene-4-carbonitrile?
The IUPAC name of 8-fluoro-2,9,9-trimethyl-1-(1-methylpyridin-1-ium-2-yl)fluorene-4-carbonitrile (CID 154615164) is 8-fluoro-2,9,9-trimethyl-1-(1-methylpyridin-1-ium-2-yl)fluorene-4-carbonitrile.
What is the SMILES notation for 8-fluoro-2,9,9-trimethyl-1-(1-methylpyridin-1-ium-2-yl)fluorene-4-carbonitrile?
The canonical SMILES for 8-fluoro-2,9,9-trimethyl-1-(1-methylpyridin-1-ium-2-yl)fluorene-4-carbonitrile is Cc1cc(C#N)c2c(c1-c1cccc[n+]1C)C(C)(C)c1c(F)cccc1-2.
What is the InChIKey of 8-fluoro-2,9,9-trimethyl-1-(1-methylpyridin-1-ium-2-yl)fluorene-4-carbonitrile?
The InChIKey is WUEWAUPEQQZOEY-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H20FN2/c1-14-12-15(13-25)20-16-8-7-9-17(24)21(16)23(2,3)22(20)19(14)18-10-5-6-11-26(18)4/h5-12H,1-4H3/q+1.
What are the key properties of 8-fluoro-2,9,9-trimethyl-1-(1-methylpyridin-1-ium-2-yl)fluorene-4-carbonitrile?
8-fluoro-2,9,9-trimethyl-1-(1-methylpyridin-1-ium-2-yl)fluorene-4-carbonitrile has a molecular weight of 343.43 g/mol, XLogP of 4.80, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 8-fluoro-2,9,9-trimethyl-1-(1-methylpyridin-1-ium-2-yl)fluorene-4-carbonitrile is sourced from PubChem (CID 154615164), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).