C24H14N2O — CID 154615902
2-[6-isocyano-7-(2,3,4,5,6-pentadeuteriophenyl)dibenzofuran-4-yl]pyridine (PubChem CID 154615902) has the molecular formula C24H14N2O and a molecular weight of 351.42 g/mol. Its IUPAC name is 2-[6-isocyano-7-(2,3,4,5,6-pentadeuteriophenyl)dibenzofuran-4-yl]pyridine.
| Compound Name | 2-[6-isocyano-7-(2,3,4,5,6-pentadeuteriophenyl)dibenzofuran-4-yl]pyridine |
|---|---|
| PubChem CID | 154615902 |
| Molecular Formula | C24H14N2O |
| Molecular Weight | 351.42 g/mol |
| Exact Mass | 351.14 |
| IUPAC Name | 2-[6-isocyano-7-(2,3,4,5,6-pentadeuteriophenyl)dibenzofuran-4-yl]pyridine |
| SMILES | [2H]c1c([2H])c([2H])c(-c2ccc3c(oc4c(-c5ccccn5)cccc43)c2[N+]#[C-])c([2H])c1[2H] |
| InChI | InChI=1S/C24H14N2O/c1-25-22-17(16-8-3-2-4-9-16)13-14-19-18-10-7-11-20(23(18)27-24(19)22)21-12-5-6-15-26-21/h2-15H/i2D,3D,4D,8D,9D |
| InChIKey | PLBVKGAVASMWOZ-VSARWYBUSA-N |
| XLogP | 6.87 |
| TPSA | 30.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.42 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|