C25H25N3O4 — CID 15461757
[acetyl-[4-[1-(4-methoxyphenyl)-5-(4-methylphenyl)pyrazol-3-yl]but-3-yn-2-yl]amino] acetate (PubChem CID 15461757) has the molecular formula C25H25N3O4 and a molecular weight of 431.49 g/mol. Its IUPAC name is [acetyl-[4-[1-(4-methoxyphenyl)-5-(4-methylphenyl)pyrazol-3-yl]but-3-yn-2-yl]amino] acetate.
| Compound Name | [acetyl-[4-[1-(4-methoxyphenyl)-5-(4-methylphenyl)pyrazol-3-yl]but-3-yn-2-yl]amino] acetate |
|---|---|
| PubChem CID | 15461757 |
| Molecular Formula | C25H25N3O4 |
| Molecular Weight | 431.49 g/mol |
| Exact Mass | 431.18 |
| IUPAC Name | [acetyl-[4-[1-(4-methoxyphenyl)-5-(4-methylphenyl)pyrazol-3-yl]but-3-yn-2-yl]amino] acetate |
| SMILES | COc1ccc(-n2nc(C#CC(C)N(OC(C)=O)C(C)=O)cc2-c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C25H25N3O4/c1-17-6-9-21(10-7-17)25-16-22(11-8-18(2)28(19(3)29)32-20(4)30)26-27(25)23-12-14-24(31-5)15-13-23/h6-7,9-10,12-16,18H,1-5H3 |
| InChIKey | WHWXFXGXQJWMLW-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 73.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.49 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|