C17H16F4N4O2 — CID 154617825
(3S)-N-(2-fluorophenyl)-1-methyl-4-[1-methyl-3-(trifluoromethyl)pyrazol-5-yl]-2-oxopyrrolidine-3-carboxamide (PubChem CID 154617825) has the molecular formula C17H16F4N4O2 and a molecular weight of 384.33 g/mol. Its IUPAC name is (3S)-N-(2-fluorophenyl)-1-methyl-4-[1-methyl-3-(trifluoromethyl)pyrazol-5-yl]-2-oxopyrrolidine-3-carboxamide.
| Compound Name | (3S)-N-(2-fluorophenyl)-1-methyl-4-[1-methyl-3-(trifluoromethyl)pyrazol-5-yl]-2-oxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 154617825 |
| Molecular Formula | C17H16F4N4O2 |
| Molecular Weight | 384.33 g/mol |
| Exact Mass | 384.12 |
| IUPAC Name | (3S)-N-(2-fluorophenyl)-1-methyl-4-[1-methyl-3-(trifluoromethyl)pyrazol-5-yl]-2-oxopyrrolidine-3-carboxamide |
| SMILES | CN1CC(c2cc(C(F)(F)F)nn2C)[C@@H](C(=O)Nc2ccccc2F)C1=O |
| InChI | InChI=1S/C17H16F4N4O2/c1-24-8-9(12-7-13(17(19,20)21)23-25(12)2)14(16(24)27)15(26)22-11-6-4-3-5-10(11)18/h3-7,9,14H,8H2,1-2H3,(H,22,26)/t9?,14-/m0/s1 |
| InChIKey | GFLKJYRJCRSBTQ-RJSPSEDBSA-N |
| XLogP | 2.39 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.33 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|