C11H12F3N3O2S — CID 154617878
1-methyl-4-[1-methyl-5-(trifluoromethyl)pyrazol-3-yl]-2-sulfanylidenepyrrolidine-3-carboxylic acid (PubChem CID 154617878) has the molecular formula C11H12F3N3O2S and a molecular weight of 307.30 g/mol. Its IUPAC name is 1-methyl-4-[1-methyl-5-(trifluoromethyl)pyrazol-3-yl]-2-sulfanylidenepyrrolidine-3-carboxylic acid.
| Compound Name | 1-methyl-4-[1-methyl-5-(trifluoromethyl)pyrazol-3-yl]-2-sulfanylidenepyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 154617878 |
| Molecular Formula | C11H12F3N3O2S |
| Molecular Weight | 307.30 g/mol |
| Exact Mass | 307.06 |
| IUPAC Name | 1-methyl-4-[1-methyl-5-(trifluoromethyl)pyrazol-3-yl]-2-sulfanylidenepyrrolidine-3-carboxylic acid |
| SMILES | CN1CC(c2cc(C(F)(F)F)n(C)n2)C(C(=O)O)C1=S |
| InChI | InChI=1S/C11H12F3N3O2S/c1-16-4-5(8(9(16)20)10(18)19)6-3-7(11(12,13)14)17(2)15-6/h3,5,8H,4H2,1-2H3,(H,18,19) |
| InChIKey | MVGMPGUYAGZGGJ-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.30 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|