C10H10F3N3O3 — CID 154617978
(3R,4R)-4-[1-methyl-5-(trifluoromethyl)pyrazol-3-yl]-2-oxopyrrolidine-3-carboxylic acid (PubChem CID 154617978) has the molecular formula C10H10F3N3O3 and a molecular weight of 277.20 g/mol. Its IUPAC name is (3R,4R)-4-[1-methyl-5-(trifluoromethyl)pyrazol-3-yl]-2-oxopyrrolidine-3-carboxylic acid.
| Compound Name | (3R,4R)-4-[1-methyl-5-(trifluoromethyl)pyrazol-3-yl]-2-oxopyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 154617978 |
| Molecular Formula | C10H10F3N3O3 |
| Molecular Weight | 277.20 g/mol |
| Exact Mass | 277.07 |
| IUPAC Name | (3R,4R)-4-[1-methyl-5-(trifluoromethyl)pyrazol-3-yl]-2-oxopyrrolidine-3-carboxylic acid |
| SMILES | Cn1nc([C@H]2CNC(=O)[C@@H]2C(=O)O)cc1C(F)(F)F |
| InChI | InChI=1S/C10H10F3N3O3/c1-16-6(10(11,12)13)2-5(15-16)4-3-14-8(17)7(4)9(18)19/h2,4,7H,3H2,1H3,(H,14,17)(H,18,19)/t4-,7-/m1/s1 |
| InChIKey | COYAJIXIKZYPIE-CLZZGJSISA-N |
| XLogP | 0.35 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.20 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|