C12H14F3N3O3 — CID 154617854
ethyl (3R,4R)-4-[1-methyl-5-(trifluoromethyl)pyrazol-3-yl]-2-oxopyrrolidine-3-carboxylate (PubChem CID 154617854) has the molecular formula C12H14F3N3O3 and a molecular weight of 305.26 g/mol. Its IUPAC name is ethyl (3R,4R)-4-[1-methyl-5-(trifluoromethyl)pyrazol-3-yl]-2-oxopyrrolidine-3-carboxylate.
| Compound Name | ethyl (3R,4R)-4-[1-methyl-5-(trifluoromethyl)pyrazol-3-yl]-2-oxopyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 154617854 |
| Molecular Formula | C12H14F3N3O3 |
| Molecular Weight | 305.26 g/mol |
| Exact Mass | 305.10 |
| IUPAC Name | ethyl (3R,4R)-4-[1-methyl-5-(trifluoromethyl)pyrazol-3-yl]-2-oxopyrrolidine-3-carboxylate |
| SMILES | CCOC(=O)[C@H]1C(=O)NC[C@@H]1c1cc(C(F)(F)F)n(C)n1 |
| InChI | InChI=1S/C12H14F3N3O3/c1-3-21-11(20)9-6(5-16-10(9)19)7-4-8(12(13,14)15)18(2)17-7/h4,6,9H,3,5H2,1-2H3,(H,16,19)/t6-,9-/m1/s1 |
| InChIKey | XZWYPDBOUJUGFL-HZGVNTEJSA-N |
| XLogP | 0.83 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.26 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|