C10H11F3N4O2 — CID 162617452
4-[1-methyl-5-(trifluoromethyl)pyrazol-3-yl]-2-oxopyrrolidine-3-carboxamide (PubChem CID 162617452) has the molecular formula C10H11F3N4O2 and a molecular weight of 276.22 g/mol. Its IUPAC name is 4-[1-methyl-5-(trifluoromethyl)pyrazol-3-yl]-2-oxopyrrolidine-3-carboxamide.
| Compound Name | 4-[1-methyl-5-(trifluoromethyl)pyrazol-3-yl]-2-oxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 162617452 |
| Molecular Formula | C10H11F3N4O2 |
| Molecular Weight | 276.22 g/mol |
| Exact Mass | 276.08 |
| IUPAC Name | 4-[1-methyl-5-(trifluoromethyl)pyrazol-3-yl]-2-oxopyrrolidine-3-carboxamide |
| SMILES | Cn1nc(C2CNC(=O)C2C(N)=O)cc1C(F)(F)F |
| InChI | InChI=1S/C10H11F3N4O2/c1-17-6(10(11,12)13)2-5(16-17)4-3-15-9(19)7(4)8(14)18/h2,4,7H,3H2,1H3,(H2,14,18)(H,15,19) |
| InChIKey | CEFYXFFLSONGSZ-UHFFFAOYSA-N |
| XLogP | -0.25 |
| TPSA | 90.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.22 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|