C54H35N5 — CID 154621787
5-(2,6-diphenylpyrimidin-4-yl)-9,15-diphenyl-14-(3-phenylphenyl)-8,13,16-triazatetracyclo[8.7.0.02,7.013,17]heptadeca-1(10),2(7),3,5,8,11,14,16-octaene (PubChem CID 154621787) has the molecular formula C54H35N5 and a molecular weight of 753.91 g/mol. Its IUPAC name is 5-(2,6-diphenylpyrimidin-4-yl)-9,15-diphenyl-14-(3-phenylphenyl)-8,13,16-triazatetracyclo[8.7.0.02,7.013,17]heptadeca-1(10),2(7),3,5,8,11,14,16-octaene.
| Compound Name | 5-(2,6-diphenylpyrimidin-4-yl)-9,15-diphenyl-14-(3-phenylphenyl)-8,13,16-triazatetracyclo[8.7.0.02,7.013,17]heptadeca-1(10),2(7),3,5,8,11,14,16-octaene |
|---|---|
| PubChem CID | 154621787 |
| Molecular Formula | C54H35N5 |
| Molecular Weight | 753.91 g/mol |
| Exact Mass | 753.29 |
| IUPAC Name | 5-(2,6-diphenylpyrimidin-4-yl)-9,15-diphenyl-14-(3-phenylphenyl)-8,13,16-triazatetracyclo[8.7.0.02,7.013,17]heptadeca-1(10),2(7),3,5,8,11,14,16-octaene |
| SMILES | c1ccc(-c2cccc(-c3c(-c4ccccc4)nc4c5c(ccn34)c(-c3ccccc3)nc3cc(-c4cc(-c6ccccc6)nc(-c6ccccc6)n4)ccc35)c2)cc1 |
| InChI | InChI=1S/C54H35N5/c1-6-17-36(18-7-1)41-27-16-28-43(33-41)52-51(39-23-12-4-13-24-39)58-54-49-44-30-29-42(34-48(44)55-50(38-21-10-3-11-22-38)45(49)31-32-59(52)54)47-35-46(37-19-8-2-9-20-37)56-53(57-47)40-25-14-5-15-26-40/h1-35H |
| InChIKey | SMCAFMWDYNNDIS-UHFFFAOYSA-N |
| XLogP | 13.49 |
| TPSA | 55.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 753.91 |
| LogP ≤ 5 | 13.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|