C21H30N2O6S — CID 154622487
methyl (2R,3S,5S)-5-formyl-3-(methanesulfonamido)-2-[(4-phenylcyclohexyl)oxymethyl]pyrrolidine-1-carboxylate (PubChem CID 154622487) has the molecular formula C21H30N2O6S and a molecular weight of 438.55 g/mol. Its IUPAC name is methyl (2R,3S,5S)-5-formyl-3-(methanesulfonamido)-2-[(4-phenylcyclohexyl)oxymethyl]pyrrolidine-1-carboxylate.
| Compound Name | methyl (2R,3S,5S)-5-formyl-3-(methanesulfonamido)-2-[(4-phenylcyclohexyl)oxymethyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 154622487 |
| Molecular Formula | C21H30N2O6S |
| Molecular Weight | 438.55 g/mol |
| Exact Mass | 438.18 |
| IUPAC Name | methyl (2R,3S,5S)-5-formyl-3-(methanesulfonamido)-2-[(4-phenylcyclohexyl)oxymethyl]pyrrolidine-1-carboxylate |
| SMILES | COC(=O)N1[C@H](C=O)C[C@H](NS(C)(=O)=O)[C@@H]1COC1CCC(c2ccccc2)CC1 |
| InChI | InChI=1S/C21H30N2O6S/c1-28-21(25)23-17(13-24)12-19(22-30(2,26)27)20(23)14-29-18-10-8-16(9-11-18)15-6-4-3-5-7-15/h3-7,13,16-20,22H,8-12,14H2,1-2H3/t16?,17-,18?,19-,20-/m0/s1 |
| InChIKey | WYBNICFTEAIKMX-TZCBXBLLSA-N |
| XLogP | 2.06 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.55 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|