C22H32N2O5S — CID 154681428
methyl (2R,3S)-5-ethenyl-3-(methanesulfonamido)-2-[(4-phenylcyclohexyl)oxymethyl]pyrrolidine-1-carboxylate (PubChem CID 154681428) has the molecular formula C22H32N2O5S and a molecular weight of 436.57 g/mol. Its IUPAC name is methyl (2R,3S)-5-ethenyl-3-(methanesulfonamido)-2-[(4-phenylcyclohexyl)oxymethyl]pyrrolidine-1-carboxylate.
| Compound Name | methyl (2R,3S)-5-ethenyl-3-(methanesulfonamido)-2-[(4-phenylcyclohexyl)oxymethyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 154681428 |
| Molecular Formula | C22H32N2O5S |
| Molecular Weight | 436.57 g/mol |
| Exact Mass | 436.20 |
| IUPAC Name | methyl (2R,3S)-5-ethenyl-3-(methanesulfonamido)-2-[(4-phenylcyclohexyl)oxymethyl]pyrrolidine-1-carboxylate |
| SMILES | C=CC1C[C@H](NS(C)(=O)=O)[C@H](COC2CCC(c3ccccc3)CC2)N1C(=O)OC |
| InChI | InChI=1S/C22H32N2O5S/c1-4-18-14-20(23-30(3,26)27)21(24(18)22(25)28-2)15-29-19-12-10-17(11-13-19)16-8-6-5-7-9-16/h4-9,17-21,23H,1,10-15H2,2-3H3/t17?,18?,19?,20-,21-/m0/s1 |
| InChIKey | LJDFJLOXDZKIRV-VYJKVFMHSA-N |
| XLogP | 3.04 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.57 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|