C13H19BN4O2 — CID 154623420
N-methanimidoyl-N-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-pyridinyl]methanimidamide (PubChem CID 154623420) has the molecular formula C13H19BN4O2 and a molecular weight of 274.13 g/mol. Its IUPAC name is N-methanimidoyl-N-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-pyridinyl]methanimidamide.
| Compound Name | N-methanimidoyl-N-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-pyridinyl]methanimidamide |
|---|---|
| PubChem CID | 154623420 |
| Molecular Formula | C13H19BN4O2 |
| Molecular Weight | 274.13 g/mol |
| Exact Mass | 274.16 |
| IUPAC Name | N-methanimidoyl-N-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-pyridinyl]methanimidamide |
| SMILES | [H]/N=C/N(/C=N/[H])c1cncc(B2OC(C)(C)C(C)(C)O2)c1 |
| InChI | InChI=1S/C13H19BN4O2/c1-12(2)13(3,4)20-14(19-12)10-5-11(7-17-6-10)18(8-15)9-16/h5-9,15-16H,1-4H3/b15-8+,16-9+ |
| InChIKey | VIYVIMIEGVMRLD-BVXMOGEKSA-N |
| XLogP | 1.40 |
| TPSA | 82.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.13 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|