C16H27NO7S — CID 154627565
8-O-tert-butyl 2-O-ethyl (1S)-3-methylsulfonyloxy-8-azabicyclo[3.2.1]octane-2,8-dicarboxylate (PubChem CID 154627565) has the molecular formula C16H27NO7S and a molecular weight of 377.46 g/mol. Its IUPAC name is 8-O-tert-butyl 2-O-ethyl (1S)-3-methylsulfonyloxy-8-azabicyclo[3.2.1]octane-2,8-dicarboxylate.
| Compound Name | 8-O-tert-butyl 2-O-ethyl (1S)-3-methylsulfonyloxy-8-azabicyclo[3.2.1]octane-2,8-dicarboxylate |
|---|---|
| PubChem CID | 154627565 |
| Molecular Formula | C16H27NO7S |
| Molecular Weight | 377.46 g/mol |
| Exact Mass | 377.15 |
| IUPAC Name | 8-O-tert-butyl 2-O-ethyl (1S)-3-methylsulfonyloxy-8-azabicyclo[3.2.1]octane-2,8-dicarboxylate |
| SMILES | CCOC(=O)C1C(OS(C)(=O)=O)CC2CC[C@@H]1N2C(=O)OC(C)(C)C |
| InChI | InChI=1S/C16H27NO7S/c1-6-22-14(18)13-11-8-7-10(9-12(13)24-25(5,20)21)17(11)15(19)23-16(2,3)4/h10-13H,6-9H2,1-5H3/t10?,11-,12?,13?/m0/s1 |
| InChIKey | KACZSVKGHWGXNY-ZNOXQBFJSA-N |
| XLogP | 1.68 |
| TPSA | 99.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.46 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|