C16H15F10NO5 — CID 91734865
ethyl 8-(2,2,3,3,3-pentafluoropropanoyl)-3-(2,2,3,3,3-pentafluoropropanoyloxy)-8-azabicyclo[3.2.1]octane-2-carboxylate (PubChem CID 91734865) has the molecular formula C16H15F10NO5 and a molecular weight of 491.28 g/mol. Its IUPAC name is ethyl 8-(2,2,3,3,3-pentafluoropropanoyl)-3-(2,2,3,3,3-pentafluoropropanoyloxy)-8-azabicyclo[3.2.1]octane-2-carboxylate.
| Compound Name | ethyl 8-(2,2,3,3,3-pentafluoropropanoyl)-3-(2,2,3,3,3-pentafluoropropanoyloxy)-8-azabicyclo[3.2.1]octane-2-carboxylate |
|---|---|
| PubChem CID | 91734865 |
| Molecular Formula | C16H15F10NO5 |
| Molecular Weight | 491.28 g/mol |
| Exact Mass | 491.08 |
| IUPAC Name | ethyl 8-(2,2,3,3,3-pentafluoropropanoyl)-3-(2,2,3,3,3-pentafluoropropanoyloxy)-8-azabicyclo[3.2.1]octane-2-carboxylate |
| SMILES | CCOC(=O)C1C(OC(=O)C(F)(F)C(F)(F)F)CC2CCC1N2C(=O)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C16H15F10NO5/c1-2-31-10(28)9-7-4-3-6(27(7)11(29)13(17,18)15(21,22)23)5-8(9)32-12(30)14(19,20)16(24,25)26/h6-9H,2-5H2,1H3 |
| InChIKey | HJEQKMCRPSDVCJ-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.28 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|