C26H26F3NO6 — CID 10815417
methyl (1R,2R,3S,5S)-3-benzoyloxy-8-[(2R)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoyl]-8-azabicyclo[3.2.1]octane-2-carboxylate (PubChem CID 10815417) has the molecular formula C26H26F3NO6 and a molecular weight of 505.49 g/mol. Its IUPAC name is methyl (1R,2R,3S,5S)-3-benzoyloxy-8-[(2R)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoyl]-8-azabicyclo[3.2.1]octane-2-carboxylate.
| Compound Name | methyl (1R,2R,3S,5S)-3-benzoyloxy-8-[(2R)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoyl]-8-azabicyclo[3.2.1]octane-2-carboxylate |
|---|---|
| PubChem CID | 10815417 |
| Molecular Formula | C26H26F3NO6 |
| Molecular Weight | 505.49 g/mol |
| Exact Mass | 505.17 |
| IUPAC Name | methyl (1R,2R,3S,5S)-3-benzoyloxy-8-[(2R)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoyl]-8-azabicyclo[3.2.1]octane-2-carboxylate |
| SMILES | COC(=O)[C@H]1[C@@H](OC(=O)c2ccccc2)C[C@@H]2CC[C@H]1N2C(=O)[C@](OC)(c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C26H26F3NO6/c1-34-23(32)21-19-14-13-18(15-20(21)36-22(31)16-9-5-3-6-10-16)30(19)24(33)25(35-2,26(27,28)29)17-11-7-4-8-12-17/h3-12,18-21H,13-15H2,1-2H3/t18-,19+,20-,21+,25+/m0/s1 |
| InChIKey | KOESKFPRDYYNCS-PNZHCHNOSA-N |
| XLogP | 3.87 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.49 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |