C13H20F3N3O — CID 154627663
(E)-N-ethyl-N-[(2R)-1-isocyanopropan-2-yl]-4-[methyl(2,2,2-trifluoroethyl)amino]but-2-enamide (PubChem CID 154627663) has the molecular formula C13H20F3N3O and a molecular weight of 291.32 g/mol. Its IUPAC name is (E)-N-ethyl-N-[(2R)-1-isocyanopropan-2-yl]-4-[methyl(2,2,2-trifluoroethyl)amino]but-2-enamide.
| Compound Name | (E)-N-ethyl-N-[(2R)-1-isocyanopropan-2-yl]-4-[methyl(2,2,2-trifluoroethyl)amino]but-2-enamide |
|---|---|
| PubChem CID | 154627663 |
| Molecular Formula | C13H20F3N3O |
| Molecular Weight | 291.32 g/mol |
| Exact Mass | 291.16 |
| IUPAC Name | (E)-N-ethyl-N-[(2R)-1-isocyanopropan-2-yl]-4-[methyl(2,2,2-trifluoroethyl)amino]but-2-enamide |
| SMILES | [C-]#[N+]C[C@@H](C)N(CC)C(=O)/C=C/CN(C)CC(F)(F)F |
| InChI | InChI=1S/C13H20F3N3O/c1-5-19(11(2)9-17-3)12(20)7-6-8-18(4)10-13(14,15)16/h6-7,11H,5,8-10H2,1-2,4H3/b7-6+/t11-/m1/s1 |
| InChIKey | KHXZUXUVTDRJFQ-XUIVZRPNSA-N |
| XLogP | 2.19 |
| TPSA | 27.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.32 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|