C23H22ClN5O2 — CID 154633695
N-[4-[1-(6-chloropyridine-3-carbonyl)-3-methyl-3,6-dihydro-2H-pyridin-4-yl]-1H-pyrrolo[2,3-b]pyridin-6-yl]-N-cyclopropylformamide (PubChem CID 154633695) has the molecular formula C23H22ClN5O2 and a molecular weight of 435.92 g/mol. Its IUPAC name is N-[4-[1-(6-chloropyridine-3-carbonyl)-3-methyl-3,6-dihydro-2H-pyridin-4-yl]-1H-pyrrolo[2,3-b]pyridin-6-yl]-N-cyclopropylformamide.
| Compound Name | N-[4-[1-(6-chloropyridine-3-carbonyl)-3-methyl-3,6-dihydro-2H-pyridin-4-yl]-1H-pyrrolo[2,3-b]pyridin-6-yl]-N-cyclopropylformamide |
|---|---|
| PubChem CID | 154633695 |
| Molecular Formula | C23H22ClN5O2 |
| Molecular Weight | 435.92 g/mol |
| Exact Mass | 435.15 |
| IUPAC Name | N-[4-[1-(6-chloropyridine-3-carbonyl)-3-methyl-3,6-dihydro-2H-pyridin-4-yl]-1H-pyrrolo[2,3-b]pyridin-6-yl]-N-cyclopropylformamide |
| SMILES | CC1CN(C(=O)c2ccc(Cl)nc2)CC=C1c1cc(N(C=O)C2CC2)nc2[nH]ccc12 |
| InChI | InChI=1S/C23H22ClN5O2/c1-14-12-28(23(31)15-2-5-20(24)26-11-15)9-7-17(14)19-10-21(29(13-30)16-3-4-16)27-22-18(19)6-8-25-22/h2,5-8,10-11,13-14,16H,3-4,9,12H2,1H3,(H,25,27) |
| InChIKey | BICQFFCHWLIGIA-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 82.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.92 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|