C24H21N5O2 — CID 154633401
N-[4-[1-(4-cyanobenzoyl)-3,6-dihydro-2H-pyridin-4-yl]-1H-pyrrolo[2,3-b]pyridin-6-yl]-N-cyclopropylformamide (PubChem CID 154633401) has the molecular formula C24H21N5O2 and a molecular weight of 411.47 g/mol. Its IUPAC name is N-[4-[1-(4-cyanobenzoyl)-3,6-dihydro-2H-pyridin-4-yl]-1H-pyrrolo[2,3-b]pyridin-6-yl]-N-cyclopropylformamide.
| Compound Name | N-[4-[1-(4-cyanobenzoyl)-3,6-dihydro-2H-pyridin-4-yl]-1H-pyrrolo[2,3-b]pyridin-6-yl]-N-cyclopropylformamide |
|---|---|
| PubChem CID | 154633401 |
| Molecular Formula | C24H21N5O2 |
| Molecular Weight | 411.47 g/mol |
| Exact Mass | 411.17 |
| IUPAC Name | N-[4-[1-(4-cyanobenzoyl)-3,6-dihydro-2H-pyridin-4-yl]-1H-pyrrolo[2,3-b]pyridin-6-yl]-N-cyclopropylformamide |
| SMILES | N#Cc1ccc(C(=O)N2CC=C(c3cc(N(C=O)C4CC4)nc4[nH]ccc34)CC2)cc1 |
| InChI | InChI=1S/C24H21N5O2/c25-14-16-1-3-18(4-2-16)24(31)28-11-8-17(9-12-28)21-13-22(29(15-30)19-5-6-19)27-23-20(21)7-10-26-23/h1-4,7-8,10,13,15,19H,5-6,9,11-12H2,(H,26,27) |
| InChIKey | OKVXAFXNXZWCCU-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 93.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.47 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|