C29H32N6O4 — CID 154633600
N-cyclopropyl-N-[4-[4-[[1-(4-nitrobenzoyl)piperidin-4-yl]amino]cyclohexen-1-yl]-1H-pyrrolo[2,3-b]pyridin-6-yl]formamide (PubChem CID 154633600) has the molecular formula C29H32N6O4 and a molecular weight of 528.61 g/mol. Its IUPAC name is N-cyclopropyl-N-[4-[4-[[1-(4-nitrobenzoyl)piperidin-4-yl]amino]cyclohexen-1-yl]-1H-pyrrolo[2,3-b]pyridin-6-yl]formamide.
| Compound Name | N-cyclopropyl-N-[4-[4-[[1-(4-nitrobenzoyl)piperidin-4-yl]amino]cyclohexen-1-yl]-1H-pyrrolo[2,3-b]pyridin-6-yl]formamide |
|---|---|
| PubChem CID | 154633600 |
| Molecular Formula | C29H32N6O4 |
| Molecular Weight | 528.61 g/mol |
| Exact Mass | 528.25 |
| IUPAC Name | N-cyclopropyl-N-[4-[4-[[1-(4-nitrobenzoyl)piperidin-4-yl]amino]cyclohexen-1-yl]-1H-pyrrolo[2,3-b]pyridin-6-yl]formamide |
| SMILES | O=CN(c1cc(C2=CCC(NC3CCN(C(=O)c4ccc([N+](=O)[O-])cc4)CC3)CC2)c2cc[nH]c2n1)C1CC1 |
| InChI | InChI=1S/C29H32N6O4/c36-18-34(23-9-10-23)27-17-26(25-11-14-30-28(25)32-27)19-1-5-21(6-2-19)31-22-12-15-33(16-13-22)29(37)20-3-7-24(8-4-20)35(38)39/h1,3-4,7-8,11,14,17-18,21-23,31H,2,5-6,9-10,12-13,15-16H2,(H,30,32) |
| InChIKey | WBFRNLJDKLRTLO-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 124.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.61 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|