C25H26N6O2 — CID 154633414
N-[4-[4-[[1-(2-cyanoacetyl)piperidin-4-yl]amino]phenyl]-1H-pyrrolo[2,3-b]pyridin-6-yl]-N-cyclopropylformamide (PubChem CID 154633414) has the molecular formula C25H26N6O2 and a molecular weight of 442.52 g/mol. Its IUPAC name is N-[4-[4-[[1-(2-cyanoacetyl)piperidin-4-yl]amino]phenyl]-1H-pyrrolo[2,3-b]pyridin-6-yl]-N-cyclopropylformamide.
| Compound Name | N-[4-[4-[[1-(2-cyanoacetyl)piperidin-4-yl]amino]phenyl]-1H-pyrrolo[2,3-b]pyridin-6-yl]-N-cyclopropylformamide |
|---|---|
| PubChem CID | 154633414 |
| Molecular Formula | C25H26N6O2 |
| Molecular Weight | 442.52 g/mol |
| Exact Mass | 442.21 |
| IUPAC Name | N-[4-[4-[[1-(2-cyanoacetyl)piperidin-4-yl]amino]phenyl]-1H-pyrrolo[2,3-b]pyridin-6-yl]-N-cyclopropylformamide |
| SMILES | N#CCC(=O)N1CCC(Nc2ccc(-c3cc(N(C=O)C4CC4)nc4[nH]ccc34)cc2)CC1 |
| InChI | InChI=1S/C25H26N6O2/c26-11-7-24(33)30-13-9-19(10-14-30)28-18-3-1-17(2-4-18)22-15-23(31(16-32)20-5-6-20)29-25-21(22)8-12-27-25/h1-4,8,12,15-16,19-20,28H,5-7,9-10,13-14H2,(H,27,29) |
| InChIKey | ITHYQWMKERTHPR-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 105.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.52 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|