C18H16F2N4O3S — CID 154633710
N-cyclopropyl-N-[4-[4-(difluoromethylsulfonylamino)phenyl]-1H-pyrrolo[2,3-b]pyridin-6-yl]formamide (PubChem CID 154633710) has the molecular formula C18H16F2N4O3S and a molecular weight of 406.41 g/mol. Its IUPAC name is N-cyclopropyl-N-[4-[4-(difluoromethylsulfonylamino)phenyl]-1H-pyrrolo[2,3-b]pyridin-6-yl]formamide.
| Compound Name | N-cyclopropyl-N-[4-[4-(difluoromethylsulfonylamino)phenyl]-1H-pyrrolo[2,3-b]pyridin-6-yl]formamide |
|---|---|
| PubChem CID | 154633710 |
| Molecular Formula | C18H16F2N4O3S |
| Molecular Weight | 406.41 g/mol |
| Exact Mass | 406.09 |
| IUPAC Name | N-cyclopropyl-N-[4-[4-(difluoromethylsulfonylamino)phenyl]-1H-pyrrolo[2,3-b]pyridin-6-yl]formamide |
| SMILES | O=CN(c1cc(-c2ccc(NS(=O)(=O)C(F)F)cc2)c2cc[nH]c2n1)C1CC1 |
| InChI | InChI=1S/C18H16F2N4O3S/c19-18(20)28(26,27)23-12-3-1-11(2-4-12)15-9-16(24(10-25)13-5-6-13)22-17-14(15)7-8-21-17/h1-4,7-10,13,18,23H,5-6H2,(H,21,22) |
| InChIKey | PTAUFQUOKZMUDU-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 95.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.41 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|