C24H20N8O3S — CID 154633351
N-cyclopropyl-N-[4-[4-[[4-(tetrazol-1-yl)phenyl]sulfonylamino]phenyl]-1H-pyrrolo[2,3-b]pyridin-6-yl]formamide (PubChem CID 154633351) has the molecular formula C24H20N8O3S and a molecular weight of 500.54 g/mol. Its IUPAC name is N-cyclopropyl-N-[4-[4-[[4-(tetrazol-1-yl)phenyl]sulfonylamino]phenyl]-1H-pyrrolo[2,3-b]pyridin-6-yl]formamide.
| Compound Name | N-cyclopropyl-N-[4-[4-[[4-(tetrazol-1-yl)phenyl]sulfonylamino]phenyl]-1H-pyrrolo[2,3-b]pyridin-6-yl]formamide |
|---|---|
| PubChem CID | 154633351 |
| Molecular Formula | C24H20N8O3S |
| Molecular Weight | 500.54 g/mol |
| Exact Mass | 500.14 |
| IUPAC Name | N-cyclopropyl-N-[4-[4-[[4-(tetrazol-1-yl)phenyl]sulfonylamino]phenyl]-1H-pyrrolo[2,3-b]pyridin-6-yl]formamide |
| SMILES | O=CN(c1cc(-c2ccc(NS(=O)(=O)c3ccc(-n4cnnn4)cc3)cc2)c2cc[nH]c2n1)C1CC1 |
| InChI | InChI=1S/C24H20N8O3S/c33-15-31(18-5-6-18)23-13-22(21-11-12-25-24(21)27-23)16-1-3-17(4-2-16)28-36(34,35)20-9-7-19(8-10-20)32-14-26-29-30-32/h1-4,7-15,18,28H,5-6H2,(H,25,27) |
| InChIKey | FBYPDDLBTVMVEJ-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 138.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.54 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|