C18H20N6O3S — CID 154633861
N-cyclopropyl-N-[4-[1-(1-methylsulfonylazetidin-3-yl)pyrazol-4-yl]-1H-pyrrolo[2,3-b]pyridin-6-yl]formamide (PubChem CID 154633861) has the molecular formula C18H20N6O3S and a molecular weight of 400.46 g/mol. Its IUPAC name is N-cyclopropyl-N-[4-[1-(1-methylsulfonylazetidin-3-yl)pyrazol-4-yl]-1H-pyrrolo[2,3-b]pyridin-6-yl]formamide.
| Compound Name | N-cyclopropyl-N-[4-[1-(1-methylsulfonylazetidin-3-yl)pyrazol-4-yl]-1H-pyrrolo[2,3-b]pyridin-6-yl]formamide |
|---|---|
| PubChem CID | 154633861 |
| Molecular Formula | C18H20N6O3S |
| Molecular Weight | 400.46 g/mol |
| Exact Mass | 400.13 |
| IUPAC Name | N-cyclopropyl-N-[4-[1-(1-methylsulfonylazetidin-3-yl)pyrazol-4-yl]-1H-pyrrolo[2,3-b]pyridin-6-yl]formamide |
| SMILES | CS(=O)(=O)N1CC(n2cc(-c3cc(N(C=O)C4CC4)nc4[nH]ccc34)cn2)C1 |
| InChI | InChI=1S/C18H20N6O3S/c1-28(26,27)22-9-14(10-22)24-8-12(7-20-24)16-6-17(23(11-25)13-2-3-13)21-18-15(16)4-5-19-18/h4-8,11,13-14H,2-3,9-10H2,1H3,(H,19,21) |
| InChIKey | RPTICJYAZOTWAU-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 104.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.46 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|