C19H18F3N5O3S — CID 154633564
N-cyclopropyl-N-[4-[4-(3,3,3-trifluoropropylsulfonylamino)phenyl]-7H-pyrrolo[2,3-d]pyrimidin-2-yl]formamide (PubChem CID 154633564) has the molecular formula C19H18F3N5O3S and a molecular weight of 453.45 g/mol. Its IUPAC name is N-cyclopropyl-N-[4-[4-(3,3,3-trifluoropropylsulfonylamino)phenyl]-7H-pyrrolo[2,3-d]pyrimidin-2-yl]formamide.
| Compound Name | N-cyclopropyl-N-[4-[4-(3,3,3-trifluoropropylsulfonylamino)phenyl]-7H-pyrrolo[2,3-d]pyrimidin-2-yl]formamide |
|---|---|
| PubChem CID | 154633564 |
| Molecular Formula | C19H18F3N5O3S |
| Molecular Weight | 453.45 g/mol |
| Exact Mass | 453.11 |
| IUPAC Name | N-cyclopropyl-N-[4-[4-(3,3,3-trifluoropropylsulfonylamino)phenyl]-7H-pyrrolo[2,3-d]pyrimidin-2-yl]formamide |
| SMILES | O=CN(c1nc(-c2ccc(NS(=O)(=O)CCC(F)(F)F)cc2)c2cc[nH]c2n1)C1CC1 |
| InChI | InChI=1S/C19H18F3N5O3S/c20-19(21,22)8-10-31(29,30)26-13-3-1-12(2-4-13)16-15-7-9-23-17(15)25-18(24-16)27(11-28)14-5-6-14/h1-4,7,9,11,14,26H,5-6,8,10H2,(H,23,24,25) |
| InChIKey | AETDYWJNSOEEKY-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 108.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.45 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|